C27H27N7O3 — CID 15989985
N-[2-(3,4-diethoxyphenyl)ethyl]-4-(tetrazolo[1,5-a]quinoxalin-4-ylamino)benzamide (PubChem CID 15989985) has the molecular formula C27H27N7O3 and a molecular weight of 497.56 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-4-(tetrazolo[1,5-a]quinoxalin-4-ylamino)benzamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-(tetrazolo[1,5-a]quinoxalin-4-ylamino)benzamide |
|---|---|
| PubChem CID | 15989985 |
| Molecular Formula | C27H27N7O3 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-(tetrazolo[1,5-a]quinoxalin-4-ylamino)benzamide |
| SMILES | CCOc1ccc(CCNC(=O)c2ccc(Nc3nc4ccccc4n4nnnc34)cc2)cc1OCC |
| InChI | InChI=1S/C27H27N7O3/c1-3-36-23-14-9-18(17-24(23)37-4-2)15-16-28-27(35)19-10-12-20(13-11-19)29-25-26-31-32-33-34(26)22-8-6-5-7-21(22)30-25/h5-14,17H,3-4,15-16H2,1-2H3,(H,28,35)(H,29,30) |
| InChIKey | UTPVTIYLZUSFQM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |