C18H20N4O2 — CID 15989995
2-N-(3,4-dimethylphenyl)-6,7-dimethoxyquinazoline-2,4-diamine (PubChem CID 15989995) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-N-(3,4-dimethylphenyl)-6,7-dimethoxyquinazoline-2,4-diamine.
| Compound Name | 2-N-(3,4-dimethylphenyl)-6,7-dimethoxyquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 15989995 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-N-(3,4-dimethylphenyl)-6,7-dimethoxyquinazoline-2,4-diamine |
| SMILES | COc1cc2nc(Nc3ccc(C)c(C)c3)nc(N)c2cc1OC |
| InChI | InChI=1S/C18H20N4O2/c1-10-5-6-12(7-11(10)2)20-18-21-14-9-16(24-4)15(23-3)8-13(14)17(19)22-18/h5-9H,1-4H3,(H3,19,20,21,22) |
| InChIKey | SDANCVKNDHKHSF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |