About N-(2-aminoethyl)-N'-[7-bromo-3-(trifluoromethyl)-9H-thioxanthen-1-yl]propane-1,3-diamine
N-(2-aminoethyl)-N'-[7-bromo-3-(trifluoromethyl)-9H-thioxanthen-1-yl]propane-1,3-diamine (PubChem CID 159900270) has the molecular formula C19H21BrF3N3S
and a molecular weight of 460.36 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-[7-bromo-3-(trifluoromethyl)-9H-thioxanthen-1-yl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-N'-[7-bromo-3-(trifluoromethyl)-9H-thioxanthen-1-yl]propane-1,3-diamine |
| PubChem CID | 159900270 |
| Molecular Formula | C19H21BrF3N3S |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | N-(2-aminoethyl)-N'-[7-bromo-3-(trifluoromethyl)-9H-thioxanthen-1-yl]propane-1,3-diamine |
| SMILES | NCCNCCCNc1cc(C(F)(F)F)cc2c1Cc1cc(Br)ccc1S2 |
| InChI | InChI=1S/C19H21BrF3N3S/c20-14-2-3-17-12(8-14)9-15-16(26-6-1-5-25-7-4-24)10-13(19(21,22)23)11-18(15)27-17/h2-3,8,10-11,25-26H,1,4-7,9,24H2 |
| InChIKey | NVWCRSLNWLEDSD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)-N'-[7-bromo-3-(trifluoromethyl)-9H-thioxanthen-1-yl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-N'-[7-bromo-3-(trifluoromethyl)-9H-thioxanthen-1-yl]propane-1,3-diamine?
The IUPAC name of N-(2-aminoethyl)-N'-[7-bromo-3-(trifluoromethyl)-9H-thioxanthen-1-yl]propane-1,3-diamine (CID 159900270) is N-(2-aminoethyl)-N'-[7-bromo-3-(trifluoromethyl)-9H-thioxanthen-1-yl]propane-1,3-diamine.
What is the SMILES notation for N-(2-aminoethyl)-N'-[7-bromo-3-(trifluoromethyl)-9H-thioxanthen-1-yl]propane-1,3-diamine?
The canonical SMILES for N-(2-aminoethyl)-N'-[7-bromo-3-(trifluoromethyl)-9H-thioxanthen-1-yl]propane-1,3-diamine is NCCNCCCNc1cc(C(F)(F)F)cc2c1Cc1cc(Br)ccc1S2.
What is the InChIKey of N-(2-aminoethyl)-N'-[7-bromo-3-(trifluoromethyl)-9H-thioxanthen-1-yl]propane-1,3-diamine?
The InChIKey is NVWCRSLNWLEDSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21BrF3N3S/c20-14-2-3-17-12(8-14)9-15-16(26-6-1-5-25-7-4-24)10-13(19(21,22)23)11-18(15)27-17/h2-3,8,10-11,25-26H,1,4-7,9,24H2.
What are the key properties of N-(2-aminoethyl)-N'-[7-bromo-3-(trifluoromethyl)-9H-thioxanthen-1-yl]propane-1,3-diamine?
N-(2-aminoethyl)-N'-[7-bromo-3-(trifluoromethyl)-9H-thioxanthen-1-yl]propane-1,3-diamine has a molecular weight of 460.36 g/mol, XLogP of 4.87, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-N'-[7-bromo-3-(trifluoromethyl)-9H-thioxanthen-1-yl]propane-1,3-diamine is sourced from PubChem (CID 159900270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).