C19H21N3O5S2 — CID 15990050
butyl 4-[(3,7-dimethyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)sulfonylamino]benzoate (PubChem CID 15990050) has the molecular formula C19H21N3O5S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is butyl 4-[(3,7-dimethyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)sulfonylamino]benzoate.
| Compound Name | butyl 4-[(3,7-dimethyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 15990050 |
| Molecular Formula | C19H21N3O5S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | butyl 4-[(3,7-dimethyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)sulfonylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NS(=O)(=O)c2c(C)nc3scc(C)n3c2=O)cc1 |
| InChI | InChI=1S/C19H21N3O5S2/c1-4-5-10-27-18(24)14-6-8-15(9-7-14)21-29(25,26)16-13(3)20-19-22(17(16)23)12(2)11-28-19/h6-9,11,21H,4-5,10H2,1-3H3 |
| InChIKey | YTNOCZGHTUVCFM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|