C18H20N4O4S2 — CID 15990080
3,7-dimethyl-N-(4-morpholin-4-ylphenyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-sulfonamide (PubChem CID 15990080) has the molecular formula C18H20N4O4S2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 3,7-dimethyl-N-(4-morpholin-4-ylphenyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-sulfonamide.
| Compound Name | 3,7-dimethyl-N-(4-morpholin-4-ylphenyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-sulfonamide |
|---|---|
| PubChem CID | 15990080 |
| Molecular Formula | C18H20N4O4S2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 3,7-dimethyl-N-(4-morpholin-4-ylphenyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-sulfonamide |
| SMILES | Cc1nc2scc(C)n2c(=O)c1S(=O)(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H20N4O4S2/c1-12-11-27-18-19-13(2)16(17(23)22(12)18)28(24,25)20-14-3-5-15(6-4-14)21-7-9-26-10-8-21/h3-6,11,20H,7-10H2,1-2H3 |
| InChIKey | JUUWNIIXPHIWON-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|