About 6,7-dimethoxy-2-N-(2-methoxy-5-methylphenyl)quinazoline-2,4-diamine
6,7-dimethoxy-2-N-(2-methoxy-5-methylphenyl)quinazoline-2,4-diamine (PubChem CID 15990109) has the molecular formula C18H20N4O3
and a molecular weight of 340.38 g/mol. Its IUPAC name is 6,7-dimethoxy-2-N-(2-methoxy-5-methylphenyl)quinazoline-2,4-diamine.
Molecular Properties
| Compound Name | 6,7-dimethoxy-2-N-(2-methoxy-5-methylphenyl)quinazoline-2,4-diamine |
| PubChem CID | 15990109 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 6,7-dimethoxy-2-N-(2-methoxy-5-methylphenyl)quinazoline-2,4-diamine |
| SMILES | COc1ccc(C)cc1Nc1nc(N)c2cc(OC)c(OC)cc2n1 |
| InChI | InChI=1S/C18H20N4O3/c1-10-5-6-14(23-2)13(7-10)21-18-20-12-9-16(25-4)15(24-3)8-11(12)17(19)22-18/h5-9H,1-4H3,(H3,19,20,21,22) |
| InChIKey | HYONBFODMUSDNV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6,7-dimethoxy-2-N-(2-methoxy-5-methylphenyl)quinazoline-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-2-N-(2-methoxy-5-methylphenyl)quinazoline-2,4-diamine?
The IUPAC name of 6,7-dimethoxy-2-N-(2-methoxy-5-methylphenyl)quinazoline-2,4-diamine (CID 15990109) is 6,7-dimethoxy-2-N-(2-methoxy-5-methylphenyl)quinazoline-2,4-diamine.
What is the SMILES notation for 6,7-dimethoxy-2-N-(2-methoxy-5-methylphenyl)quinazoline-2,4-diamine?
The canonical SMILES for 6,7-dimethoxy-2-N-(2-methoxy-5-methylphenyl)quinazoline-2,4-diamine is COc1ccc(C)cc1Nc1nc(N)c2cc(OC)c(OC)cc2n1.
What is the InChIKey of 6,7-dimethoxy-2-N-(2-methoxy-5-methylphenyl)quinazoline-2,4-diamine?
The InChIKey is HYONBFODMUSDNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O3/c1-10-5-6-14(23-2)13(7-10)21-18-20-12-9-16(25-4)15(24-3)8-11(12)17(19)22-18/h5-9H,1-4H3,(H3,19,20,21,22).
What are the key properties of 6,7-dimethoxy-2-N-(2-methoxy-5-methylphenyl)quinazoline-2,4-diamine?
6,7-dimethoxy-2-N-(2-methoxy-5-methylphenyl)quinazoline-2,4-diamine has a molecular weight of 340.38 g/mol, XLogP of 3.29, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-2-N-(2-methoxy-5-methylphenyl)quinazoline-2,4-diamine is sourced from PubChem (CID 15990109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).