About 3-(3,4-dimethylanilino)-2-(4-methoxyphenyl)inden-1-one
3-(3,4-dimethylanilino)-2-(4-methoxyphenyl)inden-1-one (PubChem CID 15990165) has the molecular formula C24H21NO2
and a molecular weight of 355.44 g/mol. Its IUPAC name is 3-(3,4-dimethylanilino)-2-(4-methoxyphenyl)inden-1-one.
Molecular Properties
| Compound Name | 3-(3,4-dimethylanilino)-2-(4-methoxyphenyl)inden-1-one |
| PubChem CID | 15990165 |
| Molecular Formula | C24H21NO2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 3-(3,4-dimethylanilino)-2-(4-methoxyphenyl)inden-1-one |
| SMILES | COc1ccc(C2=C(Nc3ccc(C)c(C)c3)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H21NO2/c1-15-8-11-18(14-16(15)2)25-23-20-6-4-5-7-21(20)24(26)22(23)17-9-12-19(27-3)13-10-17/h4-14,25H,1-3H3 |
| InChIKey | MBJFFRFIVHVUPO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dimethylanilino)-2-(4-methoxyphenyl)inden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethylanilino)-2-(4-methoxyphenyl)inden-1-one?
The IUPAC name of 3-(3,4-dimethylanilino)-2-(4-methoxyphenyl)inden-1-one (CID 15990165) is 3-(3,4-dimethylanilino)-2-(4-methoxyphenyl)inden-1-one.
What is the SMILES notation for 3-(3,4-dimethylanilino)-2-(4-methoxyphenyl)inden-1-one?
The canonical SMILES for 3-(3,4-dimethylanilino)-2-(4-methoxyphenyl)inden-1-one is COc1ccc(C2=C(Nc3ccc(C)c(C)c3)c3ccccc3C2=O)cc1.
What is the InChIKey of 3-(3,4-dimethylanilino)-2-(4-methoxyphenyl)inden-1-one?
The InChIKey is MBJFFRFIVHVUPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21NO2/c1-15-8-11-18(14-16(15)2)25-23-20-6-4-5-7-21(20)24(26)22(23)17-9-12-19(27-3)13-10-17/h4-14,25H,1-3H3.
What are the key properties of 3-(3,4-dimethylanilino)-2-(4-methoxyphenyl)inden-1-one?
3-(3,4-dimethylanilino)-2-(4-methoxyphenyl)inden-1-one has a molecular weight of 355.44 g/mol, XLogP of 5.49, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethylanilino)-2-(4-methoxyphenyl)inden-1-one is sourced from PubChem (CID 15990165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).