About N-[2,4-bis(4-ethoxyanilino)-6-methylpyrimidin-5-yl]-3-fluorobenzamide
N-[2,4-bis(4-ethoxyanilino)-6-methylpyrimidin-5-yl]-3-fluorobenzamide (PubChem CID 15990250) has the molecular formula C28H28FN5O3
and a molecular weight of 501.56 g/mol. Its IUPAC name is N-[2,4-bis(4-ethoxyanilino)-6-methylpyrimidin-5-yl]-3-fluorobenzamide.
Molecular Properties
| Compound Name | N-[2,4-bis(4-ethoxyanilino)-6-methylpyrimidin-5-yl]-3-fluorobenzamide |
| PubChem CID | 15990250 |
| Molecular Formula | C28H28FN5O3 |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | N-[2,4-bis(4-ethoxyanilino)-6-methylpyrimidin-5-yl]-3-fluorobenzamide |
| SMILES | CCOc1ccc(Nc2nc(C)c(NC(=O)c3cccc(F)c3)c(Nc3ccc(OCC)cc3)n2)cc1 |
| InChI | InChI=1S/C28H28FN5O3/c1-4-36-23-13-9-21(10-14-23)31-26-25(33-27(35)19-7-6-8-20(29)17-19)18(3)30-28(34-26)32-22-11-15-24(16-12-22)37-5-2/h6-17H,4-5H2,1-3H3,(H,33,35)(H2,30,31,32,34) |
| InChIKey | UQBZRGWUDBWRMU-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[2,4-bis(4-ethoxyanilino)-6-methylpyrimidin-5-yl]-3-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,4-bis(4-ethoxyanilino)-6-methylpyrimidin-5-yl]-3-fluorobenzamide?
The IUPAC name of N-[2,4-bis(4-ethoxyanilino)-6-methylpyrimidin-5-yl]-3-fluorobenzamide (CID 15990250) is N-[2,4-bis(4-ethoxyanilino)-6-methylpyrimidin-5-yl]-3-fluorobenzamide.
What is the SMILES notation for N-[2,4-bis(4-ethoxyanilino)-6-methylpyrimidin-5-yl]-3-fluorobenzamide?
The canonical SMILES for N-[2,4-bis(4-ethoxyanilino)-6-methylpyrimidin-5-yl]-3-fluorobenzamide is CCOc1ccc(Nc2nc(C)c(NC(=O)c3cccc(F)c3)c(Nc3ccc(OCC)cc3)n2)cc1.
What is the InChIKey of N-[2,4-bis(4-ethoxyanilino)-6-methylpyrimidin-5-yl]-3-fluorobenzamide?
The InChIKey is UQBZRGWUDBWRMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28FN5O3/c1-4-36-23-13-9-21(10-14-23)31-26-25(33-27(35)19-7-6-8-20(29)17-19)18(3)30-28(34-26)32-22-11-15-24(16-12-22)37-5-2/h6-17H,4-5H2,1-3H3,(H,33,35)(H2,30,31,32,34).
What are the key properties of N-[2,4-bis(4-ethoxyanilino)-6-methylpyrimidin-5-yl]-3-fluorobenzamide?
N-[2,4-bis(4-ethoxyanilino)-6-methylpyrimidin-5-yl]-3-fluorobenzamide has a molecular weight of 501.56 g/mol, XLogP of 6.46, 10 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,4-bis(4-ethoxyanilino)-6-methylpyrimidin-5-yl]-3-fluorobenzamide is sourced from PubChem (CID 15990250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).