C21H22N4O4 — CID 15990270
2-(1,3-benzodioxol-5-yl)-5-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3,4-oxadiazole (PubChem CID 15990270) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-5-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3,4-oxadiazole.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-5-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 15990270 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-5-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3,4-oxadiazole |
| SMILES | COc1ccc(N2CCN(Cc3nnc(-c4ccc5c(c4)OCO5)o3)CC2)cc1 |
| InChI | InChI=1S/C21H22N4O4/c1-26-17-5-3-16(4-6-17)25-10-8-24(9-11-25)13-20-22-23-21(29-20)15-2-7-18-19(12-15)28-14-27-18/h2-7,12H,8-11,13-14H2,1H3 |
| InChIKey | NSKJLHCWWSGIDZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 73.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|