C25H22FN5O — CID 15990271
N-[2,4-bis(3-methylanilino)pyrimidin-5-yl]-3-fluorobenzamide (PubChem CID 15990271) has the molecular formula C25H22FN5O and a molecular weight of 427.48 g/mol. Its IUPAC name is N-[2,4-bis(3-methylanilino)pyrimidin-5-yl]-3-fluorobenzamide.
| Compound Name | N-[2,4-bis(3-methylanilino)pyrimidin-5-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 15990271 |
| Molecular Formula | C25H22FN5O |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | N-[2,4-bis(3-methylanilino)pyrimidin-5-yl]-3-fluorobenzamide |
| SMILES | Cc1cccc(Nc2ncc(NC(=O)c3cccc(F)c3)c(Nc3cccc(C)c3)n2)c1 |
| InChI | InChI=1S/C25H22FN5O/c1-16-6-3-10-20(12-16)28-23-22(30-24(32)18-8-5-9-19(26)14-18)15-27-25(31-23)29-21-11-4-7-17(2)13-21/h3-15H,1-2H3,(H,30,32)(H2,27,28,29,31) |
| InChIKey | QKFJKBRSUBYXSD-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |