C23H27N3O4S — CID 15990304
2-[[2,5-bis(4-methoxyphenyl)-1H-imidazol-4-yl]sulfanyl]-N-(3-methoxypropyl)acetamide (PubChem CID 15990304) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is 2-[[2,5-bis(4-methoxyphenyl)-1H-imidazol-4-yl]sulfanyl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[[2,5-bis(4-methoxyphenyl)-1H-imidazol-4-yl]sulfanyl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 15990304 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 2-[[2,5-bis(4-methoxyphenyl)-1H-imidazol-4-yl]sulfanyl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CSc1nc(-c2ccc(OC)cc2)[nH]c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H27N3O4S/c1-28-14-4-13-24-20(27)15-31-23-21(16-5-9-18(29-2)10-6-16)25-22(26-23)17-7-11-19(30-3)12-8-17/h5-12H,4,13-15H2,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | VBXCXTYXAHVIIL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|