About methane;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine
methane;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine (PubChem CID 159903328) has the molecular formula C16H34F3NO2
and a molecular weight of 329.45 g/mol. Its IUPAC name is methane;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine.
Molecular Properties
| Compound Name | methane;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine |
| PubChem CID | 159903328 |
| Molecular Formula | C16H34F3NO2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | methane;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine |
| SMILES | C.CC(C)CCCOCCOCCNC(C(C)C)C(F)(F)F |
| InChI | InChI=1S/C15H30F3NO2.CH4/c1-12(2)6-5-8-20-10-11-21-9-7-19-14(13(3)4)15(16,17)18;/h12-14,19H,5-11H2,1-4H3;1H4 |
| InChIKey | NWFYARIPUBGBGP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methane;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine?
The IUPAC name of methane;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine (CID 159903328) is methane;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine.
What is the SMILES notation for methane;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine?
The canonical SMILES for methane;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine is C.CC(C)CCCOCCOCCNC(C(C)C)C(F)(F)F.
What is the InChIKey of methane;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine?
The InChIKey is NWFYARIPUBGBGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30F3NO2.CH4/c1-12(2)6-5-8-20-10-11-21-9-7-19-14(13(3)4)15(16,17)18;/h12-14,19H,5-11H2,1-4H3;1H4.
What are the key properties of methane;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine?
methane;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine has a molecular weight of 329.45 g/mol, XLogP of 4.27, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1,1,1-trifluoro-3-methyl-N-[2-[2-(4-methylpentoxy)ethoxy]ethyl]butan-2-amine is sourced from PubChem (CID 159903328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).