C24H23FN8OS2 — CID 159903442
(1R,4R,5R)-2-[8-ethyl-6-fluoro-2-[[2-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-thiazol-5-yl]sulfanyl]-9H-pyrimido[4,5-b]indol-4-yl]-2-azabicyclo[2.2.1]heptan-5-amine (PubChem CID 159903442) has the molecular formula C24H23FN8OS2 and a molecular weight of 522.64 g/mol. Its IUPAC name is (1R,4R,5R)-2-[8-ethyl-6-fluoro-2-[[2-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-thiazol-5-yl]sulfanyl]-9H-pyrimido[4,5-b]indol-4-yl]-2-azabicyclo[2.2.1]heptan-5-amine.
| Compound Name | (1R,4R,5R)-2-[8-ethyl-6-fluoro-2-[[2-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-thiazol-5-yl]sulfanyl]-9H-pyrimido[4,5-b]indol-4-yl]-2-azabicyclo[2.2.1]heptan-5-amine |
|---|---|
| PubChem CID | 159903442 |
| Molecular Formula | C24H23FN8OS2 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | (1R,4R,5R)-2-[8-ethyl-6-fluoro-2-[[2-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-thiazol-5-yl]sulfanyl]-9H-pyrimido[4,5-b]indol-4-yl]-2-azabicyclo[2.2.1]heptan-5-amine |
| SMILES | CCc1cc(F)cc2c1[nH]c1nc(Sc3cnc(-c4nnc(C)o4)s3)nc(N3C[C@H]4C[C@@H]3C[C@H]4N)c12 |
| InChI | InChI=1S/C24H23FN8OS2/c1-3-11-4-13(25)6-15-18-20(28-19(11)15)29-24(30-21(18)33-9-12-5-14(33)7-16(12)26)36-17-8-27-23(35-17)22-32-31-10(2)34-22/h4,6,8,12,14,16H,3,5,7,9,26H2,1-2H3,(H,28,29,30)/t12-,14-,16-/m1/s1 |
| InChIKey | MASOIKWSSZCATQ-XNRPHZJLSA-N |
| XLogP | 4.70 |
| TPSA | 122.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |