About chlorobenzene;undecane-5,5-diol
chlorobenzene;undecane-5,5-diol (PubChem CID 159903559) has the molecular formula C17H29ClO2
and a molecular weight of 300.87 g/mol. Its IUPAC name is chlorobenzene;undecane-5,5-diol.
Molecular Properties
| Compound Name | chlorobenzene;undecane-5,5-diol |
| PubChem CID | 159903559 |
| Molecular Formula | C17H29ClO2 |
| Molecular Weight | 300.87 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | chlorobenzene;undecane-5,5-diol |
| SMILES | CCCCCCC(O)(O)CCCC.Clc1ccccc1 |
| InChI | InChI=1S/C11H24O2.C6H5Cl/c1-3-5-7-8-10-11(12,13)9-6-4-2;7-6-4-2-1-3-5-6/h12-13H,3-10H2,1-2H3;1-5H |
| InChIKey | NWGSEVZGFKQKDJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.87 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze chlorobenzene;undecane-5,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorobenzene;undecane-5,5-diol?
The IUPAC name of chlorobenzene;undecane-5,5-diol (CID 159903559) is chlorobenzene;undecane-5,5-diol.
What is the SMILES notation for chlorobenzene;undecane-5,5-diol?
The canonical SMILES for chlorobenzene;undecane-5,5-diol is CCCCCCC(O)(O)CCCC.Clc1ccccc1.
What is the InChIKey of chlorobenzene;undecane-5,5-diol?
The InChIKey is NWGSEVZGFKQKDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O2.C6H5Cl/c1-3-5-7-8-10-11(12,13)9-6-4-2;7-6-4-2-1-3-5-6/h12-13H,3-10H2,1-2H3;1-5H.
What are the key properties of chlorobenzene;undecane-5,5-diol?
chlorobenzene;undecane-5,5-diol has a molecular weight of 300.87 g/mol, XLogP of 5.17, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chlorobenzene;undecane-5,5-diol is sourced from PubChem (CID 159903559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).