About N-[6-(benzylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-4-propan-2-ylbenzenesulfonamide
N-[6-(benzylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-4-propan-2-ylbenzenesulfonamide (PubChem CID 15990426) has the molecular formula C25H28N4O3S
and a molecular weight of 464.59 g/mol. Its IUPAC name is N-[6-(benzylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-4-propan-2-ylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[6-(benzylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-4-propan-2-ylbenzenesulfonamide |
| PubChem CID | 15990426 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | N-[6-(benzylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-4-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)Nc2cc3c(cc2NCc2ccccc2)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C25H28N4O3S/c1-17(2)19-10-12-20(13-11-19)33(31,32)27-22-15-24-23(28(3)25(30)29(24)4)14-21(22)26-16-18-8-6-5-7-9-18/h5-15,17,26-27H,16H2,1-4H3 |
| InChIKey | LYHKRJWYJOYSQO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[6-(benzylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-4-propan-2-ylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(benzylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-4-propan-2-ylbenzenesulfonamide?
The IUPAC name of N-[6-(benzylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-4-propan-2-ylbenzenesulfonamide (CID 15990426) is N-[6-(benzylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-4-propan-2-ylbenzenesulfonamide.
What is the SMILES notation for N-[6-(benzylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-4-propan-2-ylbenzenesulfonamide?
The canonical SMILES for N-[6-(benzylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-4-propan-2-ylbenzenesulfonamide is CC(C)c1ccc(S(=O)(=O)Nc2cc3c(cc2NCc2ccccc2)n(C)c(=O)n3C)cc1.
What is the InChIKey of N-[6-(benzylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-4-propan-2-ylbenzenesulfonamide?
The InChIKey is LYHKRJWYJOYSQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N4O3S/c1-17(2)19-10-12-20(13-11-19)33(31,32)27-22-15-24-23(28(3)25(30)29(24)4)14-21(22)26-16-18-8-6-5-7-9-18/h5-15,17,26-27H,16H2,1-4H3.
What are the key properties of N-[6-(benzylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-4-propan-2-ylbenzenesulfonamide?
N-[6-(benzylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-4-propan-2-ylbenzenesulfonamide has a molecular weight of 464.59 g/mol, XLogP of 4.41, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(benzylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-4-propan-2-ylbenzenesulfonamide is sourced from PubChem (CID 15990426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).