C36H37Br2Cl2NO2S3 — CID 159905399
ethyl 2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-chlorobenzenecarbodithioate;ethyl 2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-chlorobenzenecarboximidothioate (PubChem CID 159905399) has the molecular formula C36H37Br2Cl2NO2S3 and a molecular weight of 842.61 g/mol. Its IUPAC name is ethyl 2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-chlorobenzenecarbodithioate;ethyl 2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-chlorobenzenecarboximidothioate.
| Compound Name | ethyl 2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-chlorobenzenecarbodithioate;ethyl 2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-chlorobenzenecarboximidothioate |
|---|---|
| PubChem CID | 159905399 |
| Molecular Formula | C36H37Br2Cl2NO2S3 |
| Molecular Weight | 842.61 g/mol |
| Exact Mass | 838.97 |
| IUPAC Name | ethyl 2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-chlorobenzenecarbodithioate;ethyl 2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-chlorobenzenecarboximidothioate |
| SMILES | CCSC(=S)c1cccc(Cl)c1CCc1cc(Br)ccc1OC.[H]/N=C(\SCC)c1cccc(Cl)c1CCc1cc(Br)ccc1OC |
| InChI | InChI=1S/C18H19BrClNOS.C18H18BrClOS2/c1-3-23-18(21)15-5-4-6-16(20)14(15)9-7-12-11-13(19)8-10-17(12)22-2;1-3-23-18(22)15-5-4-6-16(20)14(15)9-7-12-11-13(19)8-10-17(12)21-2/h4-6,8,10-11,21H,3,7,9H2,1-2H3;4-6,8,10-11H,3,7,9H2,1-2H3/b21-18-; |
| InChIKey | NWMWTMRBYWJTPA-WIPIHYDQSA-N |
| XLogP | 12.30 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.61 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ester_B(4)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|