C24H28N2OS — CID 15990543
N-(4-methylcyclohexyl)-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 15990543) has the molecular formula C24H28N2OS and a molecular weight of 392.57 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-(4-methylcyclohexyl)-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 15990543 |
| Molecular Formula | C24H28N2OS |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | N-(4-methylcyclohexyl)-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCCC1=Nc2cc(C(=O)NC3CCC(C)CC3)ccc2Sc2ccccc21 |
| InChI | InChI=1S/C24H28N2OS/c1-3-6-20-19-7-4-5-8-22(19)28-23-14-11-17(15-21(23)26-20)24(27)25-18-12-9-16(2)10-13-18/h4-5,7-8,11,14-16,18H,3,6,9-10,12-13H2,1-2H3,(H,25,27) |
| InChIKey | BADHOFIEYOBYIV-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |