About ethyl 4-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]benzoate
ethyl 4-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]benzoate (PubChem CID 15990560) has the molecular formula C20H22N2O5S
and a molecular weight of 402.47 g/mol. Its IUPAC name is ethyl 4-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]benzoate |
| PubChem CID | 15990560 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | ethyl 4-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NS(=O)(=O)c2ccc3c(c2)CCN3C(=O)CC)cc1 |
| InChI | InChI=1S/C20H22N2O5S/c1-3-19(23)22-12-11-15-13-17(9-10-18(15)22)28(25,26)21-16-7-5-14(6-8-16)20(24)27-4-2/h5-10,13,21H,3-4,11-12H2,1-2H3 |
| InChIKey | QQMJSWFDDCBCCM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]benzoate?
The IUPAC name of ethyl 4-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]benzoate (CID 15990560) is ethyl 4-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]benzoate.
What is the SMILES notation for ethyl 4-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]benzoate?
The canonical SMILES for ethyl 4-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]benzoate is CCOC(=O)c1ccc(NS(=O)(=O)c2ccc3c(c2)CCN3C(=O)CC)cc1.
What is the InChIKey of ethyl 4-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]benzoate?
The InChIKey is QQMJSWFDDCBCCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O5S/c1-3-19(23)22-12-11-15-13-17(9-10-18(15)22)28(25,26)21-16-7-5-14(6-8-16)20(24)27-4-2/h5-10,13,21H,3-4,11-12H2,1-2H3.
What are the key properties of ethyl 4-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]benzoate?
ethyl 4-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]benzoate has a molecular weight of 402.47 g/mol, XLogP of 2.96, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]benzoate is sourced from PubChem (CID 15990560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).