About 7,8-difluoro-1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazolo[4,5-c]quinoline
7,8-difluoro-1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazolo[4,5-c]quinoline (PubChem CID 15990622) has the molecular formula C23H14F3N3
and a molecular weight of 389.38 g/mol. Its IUPAC name is 7,8-difluoro-1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazolo[4,5-c]quinoline.
Molecular Properties
| Compound Name | 7,8-difluoro-1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazolo[4,5-c]quinoline |
| PubChem CID | 15990622 |
| Molecular Formula | C23H14F3N3 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 7,8-difluoro-1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazolo[4,5-c]quinoline |
| SMILES | Cc1ccc(-c2nn(-c3ccc(F)cc3)c3c2cnc2cc(F)c(F)cc23)cc1 |
| InChI | InChI=1S/C23H14F3N3/c1-13-2-4-14(5-3-13)22-18-12-27-21-11-20(26)19(25)10-17(21)23(18)29(28-22)16-8-6-15(24)7-9-16/h2-12H,1H3 |
| InChIKey | QYPXJMUOZWTORD-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,8-difluoro-1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazolo[4,5-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-difluoro-1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazolo[4,5-c]quinoline?
The IUPAC name of 7,8-difluoro-1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazolo[4,5-c]quinoline (CID 15990622) is 7,8-difluoro-1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazolo[4,5-c]quinoline.
What is the SMILES notation for 7,8-difluoro-1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazolo[4,5-c]quinoline?
The canonical SMILES for 7,8-difluoro-1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazolo[4,5-c]quinoline is Cc1ccc(-c2nn(-c3ccc(F)cc3)c3c2cnc2cc(F)c(F)cc23)cc1.
What is the InChIKey of 7,8-difluoro-1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazolo[4,5-c]quinoline?
The InChIKey is QYPXJMUOZWTORD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14F3N3/c1-13-2-4-14(5-3-13)22-18-12-27-21-11-20(26)19(25)10-17(21)23(18)29(28-22)16-8-6-15(24)7-9-16/h2-12H,1H3.
What are the key properties of 7,8-difluoro-1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazolo[4,5-c]quinoline?
7,8-difluoro-1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazolo[4,5-c]quinoline has a molecular weight of 389.38 g/mol, XLogP of 5.97, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-difluoro-1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazolo[4,5-c]quinoline is sourced from PubChem (CID 15990622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).