C17H17N5O2 — CID 159906571
7-oxa-11,14,18,19,22-pentazatetracyclo[13.5.2.12,6.018,21]tricosa-1(21),2(23),3,5,15(22),16,19-heptaen-9-one (PubChem CID 159906571) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is 7-oxa-11,14,18,19,22-pentazatetracyclo[13.5.2.12,6.018,21]tricosa-1(21),2(23),3,5,15(22),16,19-heptaen-9-one.
| Compound Name | 7-oxa-11,14,18,19,22-pentazatetracyclo[13.5.2.12,6.018,21]tricosa-1(21),2(23),3,5,15(22),16,19-heptaen-9-one |
|---|---|
| PubChem CID | 159906571 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 7-oxa-11,14,18,19,22-pentazatetracyclo[13.5.2.12,6.018,21]tricosa-1(21),2(23),3,5,15(22),16,19-heptaen-9-one |
| SMILES | O=C1CNCCNc2ccn3ncc(c3n2)-c2cccc(c2)OC1 |
| InChI | InChI=1S/C17H17N5O2/c23-13-9-18-5-6-19-16-4-7-22-17(21-16)15(10-20-22)12-2-1-3-14(8-12)24-11-13/h1-4,7-8,10,18H,5-6,9,11H2,(H,19,21) |
| InChIKey | NWQOTJAJRVZKGU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |