C24H30CrN5O2- — CID 159906793
chromium;2-[[(2R)-2-[(2-hydroxy-3,5-dimethylphenyl)methylideneamino]cyclohexyl]iminomethyl]-4,6-dimethylphenol;azide (PubChem CID 159906793) has the molecular formula C24H30CrN5O2- and a molecular weight of 472.53 g/mol. Its IUPAC name is chromium;2-[[(2R)-2-[(2-hydroxy-3,5-dimethylphenyl)methylideneamino]cyclohexyl]iminomethyl]-4,6-dimethylphenol;azide.
| Compound Name | chromium;2-[[(2R)-2-[(2-hydroxy-3,5-dimethylphenyl)methylideneamino]cyclohexyl]iminomethyl]-4,6-dimethylphenol;azide |
|---|---|
| PubChem CID | 159906793 |
| Molecular Formula | C24H30CrN5O2- |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | chromium;2-[[(2R)-2-[(2-hydroxy-3,5-dimethylphenyl)methylideneamino]cyclohexyl]iminomethyl]-4,6-dimethylphenol;azide |
| SMILES | Cc1cc(C)c(O)c(/C=N/C2CCCC[C@H]2/N=C/c2cc(C)cc(C)c2O)c1.[Cr].[N-]=[N+]=[N-] |
| InChI | InChI=1S/C24H30N2O2.Cr.N3/c1-15-9-17(3)23(27)19(11-15)13-25-21-7-5-6-8-22(21)26-14-20-12-16(2)10-18(4)24(20)28;;1-3-2/h9-14,21-22,27-28H,5-8H2,1-4H3;;/q;;-1/b25-13+,26-14+;;/t21-,22?;;/m1../s1 |
| InChIKey | OYASVAZWIMBSDV-CFLOKMCISA-N |
| XLogP | 6.04 |
| TPSA | 123.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|