About 3-[2-(3-aminophenyl)-5-bromo-1-ethylindol-3-yl]-2,2-dimethylpropan-1-ol
3-[2-(3-aminophenyl)-5-bromo-1-ethylindol-3-yl]-2,2-dimethylpropan-1-ol (PubChem CID 159907505) has the molecular formula C21H25BrN2O
and a molecular weight of 401.35 g/mol. Its IUPAC name is 3-[2-(3-aminophenyl)-5-bromo-1-ethylindol-3-yl]-2,2-dimethylpropan-1-ol.
Molecular Properties
| Compound Name | 3-[2-(3-aminophenyl)-5-bromo-1-ethylindol-3-yl]-2,2-dimethylpropan-1-ol |
| PubChem CID | 159907505 |
| Molecular Formula | C21H25BrN2O |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 3-[2-(3-aminophenyl)-5-bromo-1-ethylindol-3-yl]-2,2-dimethylpropan-1-ol |
| SMILES | CCn1c(-c2cccc(N)c2)c(CC(C)(C)CO)c2cc(Br)ccc21 |
| InChI | InChI=1S/C21H25BrN2O/c1-4-24-19-9-8-15(22)11-17(19)18(12-21(2,3)13-25)20(24)14-6-5-7-16(23)10-14/h5-11,25H,4,12-13,23H2,1-3H3 |
| InChIKey | BVGICZGZNVEEIU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(3-aminophenyl)-5-bromo-1-ethylindol-3-yl]-2,2-dimethylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3-aminophenyl)-5-bromo-1-ethylindol-3-yl]-2,2-dimethylpropan-1-ol?
The IUPAC name of 3-[2-(3-aminophenyl)-5-bromo-1-ethylindol-3-yl]-2,2-dimethylpropan-1-ol (CID 159907505) is 3-[2-(3-aminophenyl)-5-bromo-1-ethylindol-3-yl]-2,2-dimethylpropan-1-ol.
What is the SMILES notation for 3-[2-(3-aminophenyl)-5-bromo-1-ethylindol-3-yl]-2,2-dimethylpropan-1-ol?
The canonical SMILES for 3-[2-(3-aminophenyl)-5-bromo-1-ethylindol-3-yl]-2,2-dimethylpropan-1-ol is CCn1c(-c2cccc(N)c2)c(CC(C)(C)CO)c2cc(Br)ccc21.
What is the InChIKey of 3-[2-(3-aminophenyl)-5-bromo-1-ethylindol-3-yl]-2,2-dimethylpropan-1-ol?
The InChIKey is BVGICZGZNVEEIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25BrN2O/c1-4-24-19-9-8-15(22)11-17(19)18(12-21(2,3)13-25)20(24)14-6-5-7-16(23)10-14/h5-11,25H,4,12-13,23H2,1-3H3.
What are the key properties of 3-[2-(3-aminophenyl)-5-bromo-1-ethylindol-3-yl]-2,2-dimethylpropan-1-ol?
3-[2-(3-aminophenyl)-5-bromo-1-ethylindol-3-yl]-2,2-dimethylpropan-1-ol has a molecular weight of 401.35 g/mol, XLogP of 5.23, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3-aminophenyl)-5-bromo-1-ethylindol-3-yl]-2,2-dimethylpropan-1-ol is sourced from PubChem (CID 159907505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).