About 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-benzyl-N-ethylpropanamide
3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-benzyl-N-ethylpropanamide (PubChem CID 15990781) has the molecular formula C22H26N2O4S
and a molecular weight of 414.53 g/mol. Its IUPAC name is 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-benzyl-N-ethylpropanamide.
Molecular Properties
| Compound Name | 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-benzyl-N-ethylpropanamide |
| PubChem CID | 15990781 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-benzyl-N-ethylpropanamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CCS(=O)(=O)c1ccc2c(c1)CCN2C(C)=O |
| InChI | InChI=1S/C22H26N2O4S/c1-3-23(16-18-7-5-4-6-8-18)22(26)12-14-29(27,28)20-9-10-21-19(15-20)11-13-24(21)17(2)25/h4-10,15H,3,11-14,16H2,1-2H3 |
| InChIKey | WGGQLHWRQDNUKU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-benzyl-N-ethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-benzyl-N-ethylpropanamide?
The IUPAC name of 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-benzyl-N-ethylpropanamide (CID 15990781) is 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-benzyl-N-ethylpropanamide.
What is the SMILES notation for 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-benzyl-N-ethylpropanamide?
The canonical SMILES for 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-benzyl-N-ethylpropanamide is CCN(Cc1ccccc1)C(=O)CCS(=O)(=O)c1ccc2c(c1)CCN2C(C)=O.
What is the InChIKey of 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-benzyl-N-ethylpropanamide?
The InChIKey is WGGQLHWRQDNUKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2O4S/c1-3-23(16-18-7-5-4-6-8-18)22(26)12-14-29(27,28)20-9-10-21-19(15-20)11-13-24(21)17(2)25/h4-10,15H,3,11-14,16H2,1-2H3.
What are the key properties of 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-benzyl-N-ethylpropanamide?
3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-benzyl-N-ethylpropanamide has a molecular weight of 414.53 g/mol, XLogP of 2.81, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-benzyl-N-ethylpropanamide is sourced from PubChem (CID 15990781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).