About N-cyclopentyl-2-(2,4-dimethylanilino)quinoline-4-carboxamide
N-cyclopentyl-2-(2,4-dimethylanilino)quinoline-4-carboxamide (PubChem CID 15990875) has the molecular formula C23H25N3O
and a molecular weight of 359.47 g/mol. Its IUPAC name is N-cyclopentyl-2-(2,4-dimethylanilino)quinoline-4-carboxamide.
Molecular Properties
| Compound Name | N-cyclopentyl-2-(2,4-dimethylanilino)quinoline-4-carboxamide |
| PubChem CID | 15990875 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | N-cyclopentyl-2-(2,4-dimethylanilino)quinoline-4-carboxamide |
| SMILES | Cc1ccc(Nc2cc(C(=O)NC3CCCC3)c3ccccc3n2)c(C)c1 |
| InChI | InChI=1S/C23H25N3O/c1-15-11-12-20(16(2)13-15)25-22-14-19(18-9-5-6-10-21(18)26-22)23(27)24-17-7-3-4-8-17/h5-6,9-14,17H,3-4,7-8H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | XYGBMKOTCFPFTD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopentyl-2-(2,4-dimethylanilino)quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2-(2,4-dimethylanilino)quinoline-4-carboxamide?
The IUPAC name of N-cyclopentyl-2-(2,4-dimethylanilino)quinoline-4-carboxamide (CID 15990875) is N-cyclopentyl-2-(2,4-dimethylanilino)quinoline-4-carboxamide.
What is the SMILES notation for N-cyclopentyl-2-(2,4-dimethylanilino)quinoline-4-carboxamide?
The canonical SMILES for N-cyclopentyl-2-(2,4-dimethylanilino)quinoline-4-carboxamide is Cc1ccc(Nc2cc(C(=O)NC3CCCC3)c3ccccc3n2)c(C)c1.
What is the InChIKey of N-cyclopentyl-2-(2,4-dimethylanilino)quinoline-4-carboxamide?
The InChIKey is XYGBMKOTCFPFTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O/c1-15-11-12-20(16(2)13-15)25-22-14-19(18-9-5-6-10-21(18)26-22)23(27)24-17-7-3-4-8-17/h5-6,9-14,17H,3-4,7-8H2,1-2H3,(H,24,27)(H,25,26).
What are the key properties of N-cyclopentyl-2-(2,4-dimethylanilino)quinoline-4-carboxamide?
N-cyclopentyl-2-(2,4-dimethylanilino)quinoline-4-carboxamide has a molecular weight of 359.47 g/mol, XLogP of 5.27, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2-(2,4-dimethylanilino)quinoline-4-carboxamide is sourced from PubChem (CID 15990875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).