C34H31ClF6N2O13S3 — CID 159908819
2-[4-(benzenesulfonamido)-2-methylphenyl]acetic acid;2-[2-chloro-4-(trifluoromethylsulfonyloxy)phenyl]acetic acid;2-[2-methyl-4-(trifluoromethylsulfonylamino)phenyl]acetic acid (PubChem CID 159908819) has the molecular formula C34H31ClF6N2O13S3 and a molecular weight of 921.26 g/mol. Its IUPAC name is 2-[4-(benzenesulfonamido)-2-methylphenyl]acetic acid;2-[2-chloro-4-(trifluoromethylsulfonyloxy)phenyl]acetic acid;2-[2-methyl-4-(trifluoromethylsulfonylamino)phenyl]acetic acid.
| Compound Name | 2-[4-(benzenesulfonamido)-2-methylphenyl]acetic acid;2-[2-chloro-4-(trifluoromethylsulfonyloxy)phenyl]acetic acid;2-[2-methyl-4-(trifluoromethylsulfonylamino)phenyl]acetic acid |
|---|---|
| PubChem CID | 159908819 |
| Molecular Formula | C34H31ClF6N2O13S3 |
| Molecular Weight | 921.26 g/mol |
| Exact Mass | 920.06 |
| IUPAC Name | 2-[4-(benzenesulfonamido)-2-methylphenyl]acetic acid;2-[2-chloro-4-(trifluoromethylsulfonyloxy)phenyl]acetic acid;2-[2-methyl-4-(trifluoromethylsulfonylamino)phenyl]acetic acid |
| SMILES | Cc1cc(NS(=O)(=O)C(F)(F)F)ccc1CC(=O)O.Cc1cc(NS(=O)(=O)c2ccccc2)ccc1CC(=O)O.O=C(O)Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H15NO4S.C10H10F3NO4S.C9H6ClF3O5S/c1-11-9-13(8-7-12(11)10-15(17)18)16-21(19,20)14-5-3-2-4-6-14;1-6-4-8(3-2-7(6)5-9(15)16)14-19(17,18)10(11,12)13;10-7-4-6(2-1-5(7)3-8(14)15)18-19(16,17)9(11,12)13/h2-9,16H,10H2,1H3,(H,17,18);2-4,14H,5H2,1H3,(H,15,16);1-2,4H,3H2,(H,14,15) |
| InChIKey | NWXNDUKDFUKJOZ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 247.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.26 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|