About N-benzyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide
N-benzyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide (PubChem CID 15990904) has the molecular formula C25H23N3O
and a molecular weight of 381.48 g/mol. Its IUPAC name is N-benzyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide.
Molecular Properties
| Compound Name | N-benzyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide |
| PubChem CID | 15990904 |
| Molecular Formula | C25H23N3O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-benzyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide |
| SMILES | Cc1cc(C)cc(Nc2cc(C(=O)NCc3ccccc3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C25H23N3O/c1-17-12-18(2)14-20(13-17)27-24-15-22(21-10-6-7-11-23(21)28-24)25(29)26-16-19-8-4-3-5-9-19/h3-15H,16H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | KEPGIWIWFKIQHT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide?
The IUPAC name of N-benzyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide (CID 15990904) is N-benzyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide.
What is the SMILES notation for N-benzyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide?
The canonical SMILES for N-benzyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide is Cc1cc(C)cc(Nc2cc(C(=O)NCc3ccccc3)c3ccccc3n2)c1.
What is the InChIKey of N-benzyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide?
The InChIKey is KEPGIWIWFKIQHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23N3O/c1-17-12-18(2)14-20(13-17)27-24-15-22(21-10-6-7-11-23(21)28-24)25(29)26-16-19-8-4-3-5-9-19/h3-15H,16H2,1-2H3,(H,26,29)(H,27,28).
What are the key properties of N-benzyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide?
N-benzyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide has a molecular weight of 381.48 g/mol, XLogP of 5.53, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide is sourced from PubChem (CID 15990904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).