C31H38ClN3O — CID 159909756
1-[2-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoline-3,4'-piperidine]-1'-yl]undec-10-yn-1-one (PubChem CID 159909756) has the molecular formula C31H38ClN3O and a molecular weight of 504.12 g/mol. Its IUPAC name is 1-[2-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoline-3,4'-piperidine]-1'-yl]undec-10-yn-1-one.
| Compound Name | 1-[2-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoline-3,4'-piperidine]-1'-yl]undec-10-yn-1-one |
|---|---|
| PubChem CID | 159909756 |
| Molecular Formula | C31H38ClN3O |
| Molecular Weight | 504.12 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | 1-[2-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoline-3,4'-piperidine]-1'-yl]undec-10-yn-1-one |
| SMILES | C#CCCCCCCCCC(=O)N1CCC2(CC1)Cc1ccccc1N/C2=N\Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C31H38ClN3O/c1-2-3-4-5-6-7-8-9-17-29(36)35-20-18-31(19-21-35)23-26-14-10-11-16-28(26)34-30(31)33-24-25-13-12-15-27(32)22-25/h1,10-16,22H,3-9,17-21,23-24H2,(H,33,34) |
| InChIKey | NXAOTRKODJBZSA-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.12 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|