C18H16N2O2 — CID 15991006
1-benzyl-3-(4-methylphenyl)pyrazole-5-carboxylic acid (PubChem CID 15991006) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 1-benzyl-3-(4-methylphenyl)pyrazole-5-carboxylic acid.
| Compound Name | 1-benzyl-3-(4-methylphenyl)pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 15991006 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1-benzyl-3-(4-methylphenyl)pyrazole-5-carboxylic acid |
| SMILES | Cc1ccc(-c2cc(C(=O)O)n(Cc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C18H16N2O2/c1-13-7-9-15(10-8-13)16-11-17(18(21)22)20(19-16)12-14-5-3-2-4-6-14/h2-11H,12H2,1H3,(H,21,22) |
| InChIKey | OTRPLYXESVAETE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |