C20H32N4O3 — CID 159910220
tert-butyl N-[4-(6-piperidin-1-ylpyrimidin-4-yl)oxycyclohexyl]carbamate (PubChem CID 159910220) has the molecular formula C20H32N4O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is tert-butyl N-[4-(6-piperidin-1-ylpyrimidin-4-yl)oxycyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-(6-piperidin-1-ylpyrimidin-4-yl)oxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 159910220 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | tert-butyl N-[4-(6-piperidin-1-ylpyrimidin-4-yl)oxycyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(Oc2cc(N3CCCCC3)ncn2)CC1 |
| InChI | InChI=1S/C20H32N4O3/c1-20(2,3)27-19(25)23-15-7-9-16(10-8-15)26-18-13-17(21-14-22-18)24-11-5-4-6-12-24/h13-16H,4-12H2,1-3H3,(H,23,25) |
| InChIKey | NXCAQTOBNWYMQH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |