C17H28N2O4 — CID 159911612
1,3-di(propan-2-yl)-5-propoxybenzimidazol-1-ium;oxidoperoxymethane (PubChem CID 159911612) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1,3-di(propan-2-yl)-5-propoxybenzimidazol-1-ium;oxidoperoxymethane.
| Compound Name | 1,3-di(propan-2-yl)-5-propoxybenzimidazol-1-ium;oxidoperoxymethane |
|---|---|
| PubChem CID | 159911612 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1,3-di(propan-2-yl)-5-propoxybenzimidazol-1-ium;oxidoperoxymethane |
| SMILES | CCCOc1ccc2c(c1)n(C(C)C)c[n+]2C(C)C.COO[O-] |
| InChI | InChI=1S/C16H25N2O.CH4O3/c1-6-9-19-14-7-8-15-16(10-14)18(13(4)5)11-17(15)12(2)3;1-3-4-2/h7-8,10-13H,6,9H2,1-5H3;2H,1H3/q+1;/p-1 |
| InChIKey | DUJMVDXVMLAMID-UHFFFAOYSA-M |
| XLogP | 2.72 |
| TPSA | 59.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|