About N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]pentanamide
N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]pentanamide (PubChem CID 15991171) has the molecular formula C18H19N3O2
and a molecular weight of 309.37 g/mol. Its IUPAC name is N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]pentanamide.
Molecular Properties
| Compound Name | N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]pentanamide |
| PubChem CID | 15991171 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1cccc(-c2nc3ncccc3o2)c1C |
| InChI | InChI=1S/C18H19N3O2/c1-3-4-10-16(22)20-14-8-5-7-13(12(14)2)18-21-17-15(23-18)9-6-11-19-17/h5-9,11H,3-4,10H2,1-2H3,(H,20,22) |
| InChIKey | JYXGOAILKINYOA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]pentanamide?
The IUPAC name of N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]pentanamide (CID 15991171) is N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]pentanamide.
What is the SMILES notation for N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]pentanamide?
The canonical SMILES for N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]pentanamide is CCCCC(=O)Nc1cccc(-c2nc3ncccc3o2)c1C.
What is the InChIKey of N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]pentanamide?
The InChIKey is JYXGOAILKINYOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O2/c1-3-4-10-16(22)20-14-8-5-7-13(12(14)2)18-21-17-15(23-18)9-6-11-19-17/h5-9,11H,3-4,10H2,1-2H3,(H,20,22).
What are the key properties of N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]pentanamide?
N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]pentanamide has a molecular weight of 309.37 g/mol, XLogP of 4.33, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]pentanamide is sourced from PubChem (CID 15991171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).