C26H25FN2O2S — CID 15991262
(3aR,4S,9bS)-N-(3,4-dimethylphenyl)-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 15991262) has the molecular formula C26H25FN2O2S and a molecular weight of 448.56 g/mol. Its IUPAC name is (3aR,4S,9bS)-N-(3,4-dimethylphenyl)-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | (3aR,4S,9bS)-N-(3,4-dimethylphenyl)-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 15991262 |
| Molecular Formula | C26H25FN2O2S |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | (3aR,4S,9bS)-N-(3,4-dimethylphenyl)-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc3c(c2)[C@H]2C=CC[C@H]2[C@@H](c2ccc(F)cc2)N3)cc1C |
| InChI | InChI=1S/C26H25FN2O2S/c1-16-6-11-20(14-17(16)2)29-32(30,31)21-12-13-25-24(15-21)22-4-3-5-23(22)26(28-25)18-7-9-19(27)10-8-18/h3-4,6-15,22-23,26,28-29H,5H2,1-2H3/t22-,23+,26+/m0/s1 |
| InChIKey | SHAOQNRSKRYIJH-PPJWLVRDSA-N |
| XLogP | 6.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|