C16H19F4N — CID 159912969
5-fluoro-2-pentyl-1H-indole;3,3,3-trifluoroprop-1-ene (PubChem CID 159912969) has the molecular formula C16H19F4N and a molecular weight of 301.33 g/mol. Its IUPAC name is 5-fluoro-2-pentyl-1H-indole;3,3,3-trifluoroprop-1-ene.
| Compound Name | 5-fluoro-2-pentyl-1H-indole;3,3,3-trifluoroprop-1-ene |
|---|---|
| PubChem CID | 159912969 |
| Molecular Formula | C16H19F4N |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 5-fluoro-2-pentyl-1H-indole;3,3,3-trifluoroprop-1-ene |
| SMILES | C=CC(F)(F)F.CCCCCc1cc2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C13H16FN.C3H3F3/c1-2-3-4-5-12-9-10-8-11(14)6-7-13(10)15-12;1-2-3(4,5)6/h6-9,15H,2-5H2,1H3;2H,1H2 |
| InChIKey | NXKJSSGMWRTZGF-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|