C17H30F3N5O5S2 — CID 159913618
methane;4-(3-methylimidazol-3-ium-1-yl)butane-1-sulfonate;2-(3-methylimidazol-3-ium-1-yl)ethylsulfonyl-(2,2,2-trifluoroethyl)azanide (PubChem CID 159913618) has the molecular formula C17H30F3N5O5S2 and a molecular weight of 505.59 g/mol. Its IUPAC name is methane;4-(3-methylimidazol-3-ium-1-yl)butane-1-sulfonate;2-(3-methylimidazol-3-ium-1-yl)ethylsulfonyl-(2,2,2-trifluoroethyl)azanide.
| Compound Name | methane;4-(3-methylimidazol-3-ium-1-yl)butane-1-sulfonate;2-(3-methylimidazol-3-ium-1-yl)ethylsulfonyl-(2,2,2-trifluoroethyl)azanide |
|---|---|
| PubChem CID | 159913618 |
| Molecular Formula | C17H30F3N5O5S2 |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | methane;4-(3-methylimidazol-3-ium-1-yl)butane-1-sulfonate;2-(3-methylimidazol-3-ium-1-yl)ethylsulfonyl-(2,2,2-trifluoroethyl)azanide |
| SMILES | C.C[n+]1ccn(CCCCS(=O)(=O)[O-])c1.C[n+]1ccn(CCS(=O)(=O)[N-]CC(F)(F)F)c1 |
| InChI | InChI=1S/C8H12F3N3O2S.C8H14N2O3S.CH4/c1-13-2-3-14(7-13)4-5-17(15,16)12-6-8(9,10)11;1-9-5-6-10(8-9)4-2-3-7-14(11,12)13;/h2-3,7H,4-6H2,1H3;5-6,8H,2-4,7H2,1H3;1H4 |
| InChIKey | NXMLSDYKSKSQLH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 123.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|