About ethyl 5-(3,4-dimethoxybenzoyl)oxy-1-phenylpyrazole-3-carboxylate
ethyl 5-(3,4-dimethoxybenzoyl)oxy-1-phenylpyrazole-3-carboxylate (PubChem CID 15991393) has the molecular formula C21H20N2O6
and a molecular weight of 396.40 g/mol. Its IUPAC name is ethyl 5-(3,4-dimethoxybenzoyl)oxy-1-phenylpyrazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(3,4-dimethoxybenzoyl)oxy-1-phenylpyrazole-3-carboxylate |
| PubChem CID | 15991393 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | ethyl 5-(3,4-dimethoxybenzoyl)oxy-1-phenylpyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(OC(=O)c2ccc(OC)c(OC)c2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H20N2O6/c1-4-28-21(25)16-13-19(23(22-16)15-8-6-5-7-9-15)29-20(24)14-10-11-17(26-2)18(12-14)27-3/h5-13H,4H2,1-3H3 |
| InChIKey | YMGILTLQBQYZTF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 5-(3,4-dimethoxybenzoyl)oxy-1-phenylpyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(3,4-dimethoxybenzoyl)oxy-1-phenylpyrazole-3-carboxylate?
The IUPAC name of ethyl 5-(3,4-dimethoxybenzoyl)oxy-1-phenylpyrazole-3-carboxylate (CID 15991393) is ethyl 5-(3,4-dimethoxybenzoyl)oxy-1-phenylpyrazole-3-carboxylate.
What is the SMILES notation for ethyl 5-(3,4-dimethoxybenzoyl)oxy-1-phenylpyrazole-3-carboxylate?
The canonical SMILES for ethyl 5-(3,4-dimethoxybenzoyl)oxy-1-phenylpyrazole-3-carboxylate is CCOC(=O)c1cc(OC(=O)c2ccc(OC)c(OC)c2)n(-c2ccccc2)n1.
What is the InChIKey of ethyl 5-(3,4-dimethoxybenzoyl)oxy-1-phenylpyrazole-3-carboxylate?
The InChIKey is YMGILTLQBQYZTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O6/c1-4-28-21(25)16-13-19(23(22-16)15-8-6-5-7-9-15)29-20(24)14-10-11-17(26-2)18(12-14)27-3/h5-13H,4H2,1-3H3.
What are the key properties of ethyl 5-(3,4-dimethoxybenzoyl)oxy-1-phenylpyrazole-3-carboxylate?
ethyl 5-(3,4-dimethoxybenzoyl)oxy-1-phenylpyrazole-3-carboxylate has a molecular weight of 396.40 g/mol, XLogP of 3.29, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(3,4-dimethoxybenzoyl)oxy-1-phenylpyrazole-3-carboxylate is sourced from PubChem (CID 15991393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).