About [(1S)-3,3-dimethylcyclopentyl]methanol
[(1S)-3,3-dimethylcyclopentyl]methanol (PubChem CID 159914707) has the molecular formula C8H16O
and a molecular weight of 128.22 g/mol. Its IUPAC name is [(1S)-3,3-dimethylcyclopentyl]methanol.
Molecular Properties
| Compound Name | [(1S)-3,3-dimethylcyclopentyl]methanol |
| PubChem CID | 159914707 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | [(1S)-3,3-dimethylcyclopentyl]methanol |
| SMILES | CC1(C)CC[C@H](CO)C1 |
| InChI | InChI=1S/C8H16O/c1-8(2)4-3-7(5-8)6-9/h7,9H,3-6H2,1-2H3/t7-/m0/s1 |
| InChIKey | LSZXVUJJTONWHR-ZETCQYMHSA-N |
| XLogP | 1.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(1S)-3,3-dimethylcyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-3,3-dimethylcyclopentyl]methanol?
The IUPAC name of [(1S)-3,3-dimethylcyclopentyl]methanol (CID 159914707) is [(1S)-3,3-dimethylcyclopentyl]methanol.
What is the SMILES notation for [(1S)-3,3-dimethylcyclopentyl]methanol?
The canonical SMILES for [(1S)-3,3-dimethylcyclopentyl]methanol is CC1(C)CC[C@H](CO)C1.
What is the InChIKey of [(1S)-3,3-dimethylcyclopentyl]methanol?
The InChIKey is LSZXVUJJTONWHR-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H16O/c1-8(2)4-3-7(5-8)6-9/h7,9H,3-6H2,1-2H3/t7-/m0/s1.
What are the key properties of [(1S)-3,3-dimethylcyclopentyl]methanol?
[(1S)-3,3-dimethylcyclopentyl]methanol has a molecular weight of 128.22 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-3,3-dimethylcyclopentyl]methanol is sourced from PubChem (CID 159914707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).