About 2-tert-butyl-N-methyl-N-propyl-1,3-dioxan-5-amine
2-tert-butyl-N-methyl-N-propyl-1,3-dioxan-5-amine (PubChem CID 159914721) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-tert-butyl-N-methyl-N-propyl-1,3-dioxan-5-amine.
Molecular Properties
| Compound Name | 2-tert-butyl-N-methyl-N-propyl-1,3-dioxan-5-amine |
| PubChem CID | 159914721 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 2-tert-butyl-N-methyl-N-propyl-1,3-dioxan-5-amine |
| SMILES | CCCN(C)C1COC(C(C)(C)C)OC1 |
| InChI | InChI=1S/C12H25NO2/c1-6-7-13(5)10-8-14-11(15-9-10)12(2,3)4/h10-11H,6-9H2,1-5H3 |
| InChIKey | NXQACSYUWXAGKK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-N-methyl-N-propyl-1,3-dioxan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-N-methyl-N-propyl-1,3-dioxan-5-amine?
The IUPAC name of 2-tert-butyl-N-methyl-N-propyl-1,3-dioxan-5-amine (CID 159914721) is 2-tert-butyl-N-methyl-N-propyl-1,3-dioxan-5-amine.
What is the SMILES notation for 2-tert-butyl-N-methyl-N-propyl-1,3-dioxan-5-amine?
The canonical SMILES for 2-tert-butyl-N-methyl-N-propyl-1,3-dioxan-5-amine is CCCN(C)C1COC(C(C)(C)C)OC1.
What is the InChIKey of 2-tert-butyl-N-methyl-N-propyl-1,3-dioxan-5-amine?
The InChIKey is NXQACSYUWXAGKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2/c1-6-7-13(5)10-8-14-11(15-9-10)12(2,3)4/h10-11H,6-9H2,1-5H3.
What are the key properties of 2-tert-butyl-N-methyl-N-propyl-1,3-dioxan-5-amine?
2-tert-butyl-N-methyl-N-propyl-1,3-dioxan-5-amine has a molecular weight of 215.34 g/mol, XLogP of 2.12, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-N-methyl-N-propyl-1,3-dioxan-5-amine is sourced from PubChem (CID 159914721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).