C25H31F3N4O — CID 159915214
(2R)-N-[2-[(3S)-1-benzylpyrrolidin-3-yl]ethyl]-2-methyl-4-(3,4,5-trifluorophenyl)piperazine-1-carboxamide (PubChem CID 159915214) has the molecular formula C25H31F3N4O and a molecular weight of 460.54 g/mol. Its IUPAC name is (2R)-N-[2-[(3S)-1-benzylpyrrolidin-3-yl]ethyl]-2-methyl-4-(3,4,5-trifluorophenyl)piperazine-1-carboxamide.
| Compound Name | (2R)-N-[2-[(3S)-1-benzylpyrrolidin-3-yl]ethyl]-2-methyl-4-(3,4,5-trifluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 159915214 |
| Molecular Formula | C25H31F3N4O |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | (2R)-N-[2-[(3S)-1-benzylpyrrolidin-3-yl]ethyl]-2-methyl-4-(3,4,5-trifluorophenyl)piperazine-1-carboxamide |
| SMILES | C[C@@H]1CN(c2cc(F)c(F)c(F)c2)CCN1C(=O)NCC[C@H]1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C25H31F3N4O/c1-18-15-31(21-13-22(26)24(28)23(27)14-21)11-12-32(18)25(33)29-9-7-20-8-10-30(17-20)16-19-5-3-2-4-6-19/h2-6,13-14,18,20H,7-12,15-17H2,1H3,(H,29,33)/t18-,20+/m1/s1 |
| InChIKey | NXRPKADNGWGFKY-QUCCMNQESA-N |
| XLogP | 4.24 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|