About 1H-indole;3-methylbutan-1-ol
1H-indole;3-methylbutan-1-ol (PubChem CID 159916178) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 1H-indole;3-methylbutan-1-ol.
Molecular Properties
| Compound Name | 1H-indole;3-methylbutan-1-ol |
| PubChem CID | 159916178 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1H-indole;3-methylbutan-1-ol |
| SMILES | CC(C)CCO.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.C5H12O/c1-2-4-8-7(3-1)5-6-9-8;1-5(2)3-4-6/h1-6,9H;5-6H,3-4H2,1-2H3 |
| InChIKey | NXURPCOCTJQARN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-indole;3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;3-methylbutan-1-ol?
The IUPAC name of 1H-indole;3-methylbutan-1-ol (CID 159916178) is 1H-indole;3-methylbutan-1-ol.
What is the SMILES notation for 1H-indole;3-methylbutan-1-ol?
The canonical SMILES for 1H-indole;3-methylbutan-1-ol is CC(C)CCO.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;3-methylbutan-1-ol?
The InChIKey is NXURPCOCTJQARN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C5H12O/c1-2-4-8-7(3-1)5-6-9-8;1-5(2)3-4-6/h1-6,9H;5-6H,3-4H2,1-2H3.
What are the key properties of 1H-indole;3-methylbutan-1-ol?
1H-indole;3-methylbutan-1-ol has a molecular weight of 205.30 g/mol, XLogP of 3.19, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;3-methylbutan-1-ol is sourced from PubChem (CID 159916178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).