About [1-(2-methoxyethyl)pyrrolidin-2-yl]methanol;sulfane
[1-(2-methoxyethyl)pyrrolidin-2-yl]methanol;sulfane (PubChem CID 159917406) has the molecular formula C8H19NO2S
and a molecular weight of 193.31 g/mol. Its IUPAC name is [1-(2-methoxyethyl)pyrrolidin-2-yl]methanol;sulfane.
Molecular Properties
| Compound Name | [1-(2-methoxyethyl)pyrrolidin-2-yl]methanol;sulfane |
| PubChem CID | 159917406 |
| Molecular Formula | C8H19NO2S |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | [1-(2-methoxyethyl)pyrrolidin-2-yl]methanol;sulfane |
| SMILES | COCCN1CCCC1CO.S |
| InChI | InChI=1S/C8H17NO2.H2S/c1-11-6-5-9-4-2-3-8(9)7-10;/h8,10H,2-7H2,1H3;1H2 |
| InChIKey | NXYPGADOFTWTTD-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(2-methoxyethyl)pyrrolidin-2-yl]methanol;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2-methoxyethyl)pyrrolidin-2-yl]methanol;sulfane?
The IUPAC name of [1-(2-methoxyethyl)pyrrolidin-2-yl]methanol;sulfane (CID 159917406) is [1-(2-methoxyethyl)pyrrolidin-2-yl]methanol;sulfane.
What is the SMILES notation for [1-(2-methoxyethyl)pyrrolidin-2-yl]methanol;sulfane?
The canonical SMILES for [1-(2-methoxyethyl)pyrrolidin-2-yl]methanol;sulfane is COCCN1CCCC1CO.S.
What is the InChIKey of [1-(2-methoxyethyl)pyrrolidin-2-yl]methanol;sulfane?
The InChIKey is NXYPGADOFTWTTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2.H2S/c1-11-6-5-9-4-2-3-8(9)7-10;/h8,10H,2-7H2,1H3;1H2.
What are the key properties of [1-(2-methoxyethyl)pyrrolidin-2-yl]methanol;sulfane?
[1-(2-methoxyethyl)pyrrolidin-2-yl]methanol;sulfane has a molecular weight of 193.31 g/mol, XLogP of 0.20, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-methoxyethyl)pyrrolidin-2-yl]methanol;sulfane is sourced from PubChem (CID 159917406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).