About gold;4-pyridin-4-ylpyridine
gold;4-pyridin-4-ylpyridine (PubChem CID 159917709) has the molecular formula C10H8AuN2
and a molecular weight of 353.16 g/mol. Its IUPAC name is gold;4-pyridin-4-ylpyridine.
Molecular Properties
| Compound Name | gold;4-pyridin-4-ylpyridine |
| PubChem CID | 159917709 |
| Molecular Formula | C10H8AuN2 |
| Molecular Weight | 353.16 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | gold;4-pyridin-4-ylpyridine |
| SMILES | [Au].c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C10H8N2.Au/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;/h1-8H; |
| InChIKey | NXZPNMCZEAILKP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.16 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze gold;4-pyridin-4-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold;4-pyridin-4-ylpyridine?
The IUPAC name of gold;4-pyridin-4-ylpyridine (CID 159917709) is gold;4-pyridin-4-ylpyridine.
What is the SMILES notation for gold;4-pyridin-4-ylpyridine?
The canonical SMILES for gold;4-pyridin-4-ylpyridine is [Au].c1cc(-c2ccncc2)ccn1.
What is the InChIKey of gold;4-pyridin-4-ylpyridine?
The InChIKey is NXZPNMCZEAILKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.Au/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;/h1-8H;.
What are the key properties of gold;4-pyridin-4-ylpyridine?
gold;4-pyridin-4-ylpyridine has a molecular weight of 353.16 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for gold;4-pyridin-4-ylpyridine is sourced from PubChem (CID 159917709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).