C18H21N5O — CID 159920062
7,7,8,8,13-pentamethyl-11-(1H-1,2,4-triazol-5-yl)-6,9-diazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraen-12-one (PubChem CID 159920062) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 7,7,8,8,13-pentamethyl-11-(1H-1,2,4-triazol-5-yl)-6,9-diazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraen-12-one.
| Compound Name | 7,7,8,8,13-pentamethyl-11-(1H-1,2,4-triazol-5-yl)-6,9-diazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraen-12-one |
|---|---|
| PubChem CID | 159920062 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 7,7,8,8,13-pentamethyl-11-(1H-1,2,4-triazol-5-yl)-6,9-diazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraen-12-one |
| SMILES | Cc1c2n(cc(-c3ncn[nH]3)c1=O)C(C)(C)C(C)(C)n1cccc1-2 |
| InChI | InChI=1S/C18H21N5O/c1-11-14-13-7-6-8-22(13)17(2,3)18(4,5)23(14)9-12(15(11)24)16-19-10-20-21-16/h6-10H,1-5H3,(H,19,20,21) |
| InChIKey | KDLYSVVTZPDKNH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |