C27H24N4O4 — CID 159920353
methyl N-[6-[2-ethoxy-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-3H-indol-2-yl]carbamate (PubChem CID 159920353) has the molecular formula C27H24N4O4 and a molecular weight of 468.51 g/mol. Its IUPAC name is methyl N-[6-[2-ethoxy-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-3H-indol-2-yl]carbamate.
| Compound Name | methyl N-[6-[2-ethoxy-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-3H-indol-2-yl]carbamate |
|---|---|
| PubChem CID | 159920353 |
| Molecular Formula | C27H24N4O4 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | methyl N-[6-[2-ethoxy-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-3H-indol-2-yl]carbamate |
| SMILES | CCOc1ccc(Cc2n[nH]c(=O)c3ccccc23)cc1-c1ccc2c(c1)N=C(NC(=O)OC)C2 |
| InChI | InChI=1S/C27H24N4O4/c1-3-35-24-11-8-16(13-23-19-6-4-5-7-20(19)26(32)31-30-23)12-21(24)17-9-10-18-15-25(28-22(18)14-17)29-27(33)34-2/h4-12,14H,3,13,15H2,1-2H3,(H,31,32)(H,28,29,33) |
| InChIKey | NYHWKDYXFOGSIG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |