C22H26N2O6S — CID 15992198
3-[2-(2-methoxyanilino)-1,3-thiazol-4-yl]-3-methyl-8-(propoxymethyl)-2,7-dioxaspiro[4.4]nonane-1,6-dione (PubChem CID 15992198) has the molecular formula C22H26N2O6S and a molecular weight of 446.53 g/mol. Its IUPAC name is 3-[2-(2-methoxyanilino)-1,3-thiazol-4-yl]-3-methyl-8-(propoxymethyl)-2,7-dioxaspiro[4.4]nonane-1,6-dione.
| Compound Name | 3-[2-(2-methoxyanilino)-1,3-thiazol-4-yl]-3-methyl-8-(propoxymethyl)-2,7-dioxaspiro[4.4]nonane-1,6-dione |
|---|---|
| PubChem CID | 15992198 |
| Molecular Formula | C22H26N2O6S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 3-[2-(2-methoxyanilino)-1,3-thiazol-4-yl]-3-methyl-8-(propoxymethyl)-2,7-dioxaspiro[4.4]nonane-1,6-dione |
| SMILES | CCCOCC1CC2(CC(C)(c3csc(Nc4ccccc4OC)n3)OC2=O)C(=O)O1 |
| InChI | InChI=1S/C22H26N2O6S/c1-4-9-28-11-14-10-22(18(25)29-14)13-21(2,30-19(22)26)17-12-31-20(24-17)23-15-7-5-6-8-16(15)27-3/h5-8,12,14H,4,9-11,13H2,1-3H3,(H,23,24) |
| InChIKey | LHQPWHRGXPYDGT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|