C20H19N5O3 — CID 15992243
N-[4-(1,3-benzoxazol-2-yl)phenyl]-4,6-diethoxy-1,3,5-triazin-2-amine (PubChem CID 15992243) has the molecular formula C20H19N5O3 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-yl)phenyl]-4,6-diethoxy-1,3,5-triazin-2-amine.
| Compound Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-4,6-diethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 15992243 |
| Molecular Formula | C20H19N5O3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-4,6-diethoxy-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(Nc2ccc(-c3nc4ccccc4o3)cc2)nc(OCC)n1 |
| InChI | InChI=1S/C20H19N5O3/c1-3-26-19-23-18(24-20(25-19)27-4-2)21-14-11-9-13(10-12-14)17-22-15-7-5-6-8-16(15)28-17/h5-12H,3-4H2,1-2H3,(H,21,23,24,25) |
| InChIKey | LNDLLLIEQKYIQM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |