C33H24N4Si — CID 159922758
diphenyl-(9-phenylcarbazol-3-yl)-(1,3,5-triazin-2-yl)silane (PubChem CID 159922758) has the molecular formula C33H24N4Si and a molecular weight of 504.67 g/mol. Its IUPAC name is diphenyl-(9-phenylcarbazol-3-yl)-(1,3,5-triazin-2-yl)silane.
| Compound Name | diphenyl-(9-phenylcarbazol-3-yl)-(1,3,5-triazin-2-yl)silane |
|---|---|
| PubChem CID | 159922758 |
| Molecular Formula | C33H24N4Si |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | diphenyl-(9-phenylcarbazol-3-yl)-(1,3,5-triazin-2-yl)silane |
| SMILES | c1ccc(-n2c3ccccc3c3cc([Si](c4ccccc4)(c4ccccc4)c4ncncn4)ccc32)cc1 |
| InChI | InChI=1S/C33H24N4Si/c1-4-12-25(13-5-1)37-31-19-11-10-18-29(31)30-22-28(20-21-32(30)37)38(26-14-6-2-7-15-26,27-16-8-3-9-17-27)33-35-23-34-24-36-33/h1-24H |
| InChIKey | BUNKMXOTWBARRQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|