C26H50O6Si — CID 159922925
(3aR,7S,7aR)-3a-(5,5-dimethoxypentyl)-2,2,6-trimethyl-7-tri(propan-2-yl)silyloxy-5,6,7,7a-tetrahydro-1,3-benzodioxol-4-one (PubChem CID 159922925) has the molecular formula C26H50O6Si and a molecular weight of 486.77 g/mol. Its IUPAC name is (3aR,7S,7aR)-3a-(5,5-dimethoxypentyl)-2,2,6-trimethyl-7-tri(propan-2-yl)silyloxy-5,6,7,7a-tetrahydro-1,3-benzodioxol-4-one.
| Compound Name | (3aR,7S,7aR)-3a-(5,5-dimethoxypentyl)-2,2,6-trimethyl-7-tri(propan-2-yl)silyloxy-5,6,7,7a-tetrahydro-1,3-benzodioxol-4-one |
|---|---|
| PubChem CID | 159922925 |
| Molecular Formula | C26H50O6Si |
| Molecular Weight | 486.77 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | (3aR,7S,7aR)-3a-(5,5-dimethoxypentyl)-2,2,6-trimethyl-7-tri(propan-2-yl)silyloxy-5,6,7,7a-tetrahydro-1,3-benzodioxol-4-one |
| SMILES | COC(CCCC[C@@]12OC(C)(C)O[C@@H]1[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C(C)CC2=O)OC |
| InChI | InChI=1S/C26H50O6Si/c1-17(2)33(18(3)4,19(5)6)31-23-20(7)16-21(27)26(24(23)30-25(8,9)32-26)15-13-12-14-22(28-10)29-11/h17-20,22-24H,12-16H2,1-11H3/t20?,23-,24+,26-/m0/s1 |
| InChIKey | SWENAIUYJOKBHK-WDZJDJOOSA-N |
| XLogP | 6.23 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.77 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|