About N-butyl-N-ethyl-2-[3-(4-fluorophenyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide
N-butyl-N-ethyl-2-[3-(4-fluorophenyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide (PubChem CID 15992319) has the molecular formula C20H22FN3O3S
and a molecular weight of 403.48 g/mol. Its IUPAC name is N-butyl-N-ethyl-2-[3-(4-fluorophenyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide.
Molecular Properties
| Compound Name | N-butyl-N-ethyl-2-[3-(4-fluorophenyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide |
| PubChem CID | 15992319 |
| Molecular Formula | C20H22FN3O3S |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-butyl-N-ethyl-2-[3-(4-fluorophenyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide |
| SMILES | CCCCN(CC)C(=O)Cn1c(=O)n(-c2ccc(F)cc2)c(=O)c2sccc21 |
| InChI | InChI=1S/C20H22FN3O3S/c1-3-5-11-22(4-2)17(25)13-23-16-10-12-28-18(16)19(26)24(20(23)27)15-8-6-14(21)7-9-15/h6-10,12H,3-5,11,13H2,1-2H3 |
| InChIKey | VUYDXTDCSWTYGW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-butyl-N-ethyl-2-[3-(4-fluorophenyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-ethyl-2-[3-(4-fluorophenyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide?
The IUPAC name of N-butyl-N-ethyl-2-[3-(4-fluorophenyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide (CID 15992319) is N-butyl-N-ethyl-2-[3-(4-fluorophenyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide.
What is the SMILES notation for N-butyl-N-ethyl-2-[3-(4-fluorophenyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide?
The canonical SMILES for N-butyl-N-ethyl-2-[3-(4-fluorophenyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide is CCCCN(CC)C(=O)Cn1c(=O)n(-c2ccc(F)cc2)c(=O)c2sccc21.
What is the InChIKey of N-butyl-N-ethyl-2-[3-(4-fluorophenyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide?
The InChIKey is VUYDXTDCSWTYGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22FN3O3S/c1-3-5-11-22(4-2)17(25)13-23-16-10-12-28-18(16)19(26)24(20(23)27)15-8-6-14(21)7-9-15/h6-10,12H,3-5,11,13H2,1-2H3.
What are the key properties of N-butyl-N-ethyl-2-[3-(4-fluorophenyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide?
N-butyl-N-ethyl-2-[3-(4-fluorophenyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide has a molecular weight of 403.48 g/mol, XLogP of 3.00, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-ethyl-2-[3-(4-fluorophenyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide is sourced from PubChem (CID 15992319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).