C16H26O4 — CID 159923571
methane;(2R,3R,4S)-2,3,4-trihydroxy-2-[(Z)-non-4-en-8-ynyl]cyclohexan-1-one (PubChem CID 159923571) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is methane;(2R,3R,4S)-2,3,4-trihydroxy-2-[(Z)-non-4-en-8-ynyl]cyclohexan-1-one.
| Compound Name | methane;(2R,3R,4S)-2,3,4-trihydroxy-2-[(Z)-non-4-en-8-ynyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 159923571 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | methane;(2R,3R,4S)-2,3,4-trihydroxy-2-[(Z)-non-4-en-8-ynyl]cyclohexan-1-one |
| SMILES | C.C#CCC/C=C\CCC[C@]1(O)C(=O)CC[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H22O4.CH4/c1-2-3-4-5-6-7-8-11-15(19)13(17)10-9-12(16)14(15)18;/h1,5-6,12,14,16,18-19H,3-4,7-11H2;1H4/b6-5-;/t12-,14+,15-;/m0./s1 |
| InChIKey | NYSMXLHYGCTCQT-CHAGQCKWSA-N |
| XLogP | 1.58 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|