C55H47F3O8S4 — CID 159924773
1-(2,3-dihydro-1,4-benzodithiin-6-yl)-4-[2-(trifluoromethyl)phenyl]butane-1,4-dione;bis(1-(2,3-dihydro-1,4-benzoxathiin-7-yl)-4-phenylbutane-1,4-dione) (PubChem CID 159924773) has the molecular formula C55H47F3O8S4 and a molecular weight of 1021.23 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodithiin-6-yl)-4-[2-(trifluoromethyl)phenyl]butane-1,4-dione;bis(1-(2,3-dihydro-1,4-benzoxathiin-7-yl)-4-phenylbutane-1,4-dione).
| Compound Name | 1-(2,3-dihydro-1,4-benzodithiin-6-yl)-4-[2-(trifluoromethyl)phenyl]butane-1,4-dione;bis(1-(2,3-dihydro-1,4-benzoxathiin-7-yl)-4-phenylbutane-1,4-dione) |
|---|---|
| PubChem CID | 159924773 |
| Molecular Formula | C55H47F3O8S4 |
| Molecular Weight | 1021.23 g/mol |
| Exact Mass | 1020.21 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodithiin-6-yl)-4-[2-(trifluoromethyl)phenyl]butane-1,4-dione;bis(1-(2,3-dihydro-1,4-benzoxathiin-7-yl)-4-phenylbutane-1,4-dione) |
| SMILES | O=C(CCC(=O)c1ccc2c(c1)OCCS2)c1ccccc1.O=C(CCC(=O)c1ccc2c(c1)OCCS2)c1ccccc1.O=C(CCC(=O)c1ccccc1C(F)(F)F)c1ccc2c(c1)SCCS2 |
| InChI | InChI=1S/C19H15F3O2S2.2C18H16O3S/c20-19(21,22)14-4-2-1-3-13(14)16(24)7-6-15(23)12-5-8-17-18(11-12)26-10-9-25-17;2*19-15(13-4-2-1-3-5-13)7-8-16(20)14-6-9-18-17(12-14)21-10-11-22-18/h1-5,8,11H,6-7,9-10H2;2*1-6,9,12H,7-8,10-11H2 |
| InChIKey | NYWGNABRKLQLGZ-UHFFFAOYSA-N |
| XLogP | 13.78 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1021.23 |
| LogP ≤ 5 | 13.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |